About (3R)-3-(4-fluorophenyl)thiolane 1,1-dioxide
(3R)-3-(4-fluorophenyl)thiolane 1,1-dioxide (PubChem CID 134951756) has the molecular formula C10H11FO2S
and a molecular weight of 214.26 g/mol. Its IUPAC name is (3R)-3-(4-fluorophenyl)thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | (3R)-3-(4-fluorophenyl)thiolane 1,1-dioxide |
| PubChem CID | 134951756 |
| Molecular Formula | C10H11FO2S |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | (3R)-3-(4-fluorophenyl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CC[C@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C10H11FO2S/c11-10-3-1-8(2-4-10)9-5-6-14(12,13)7-9/h1-4,9H,5-7H2/t9-/m0/s1 |
| InChIKey | GZWLOUCRIFEZGT-VIFPVBQESA-N |
| XLogP | 1.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-(4-fluorophenyl)thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(4-fluorophenyl)thiolane 1,1-dioxide?
The IUPAC name of (3R)-3-(4-fluorophenyl)thiolane 1,1-dioxide (CID 134951756) is (3R)-3-(4-fluorophenyl)thiolane 1,1-dioxide.
What is the SMILES notation for (3R)-3-(4-fluorophenyl)thiolane 1,1-dioxide?
The canonical SMILES for (3R)-3-(4-fluorophenyl)thiolane 1,1-dioxide is O=S1(=O)CC[C@H](c2ccc(F)cc2)C1.
What is the InChIKey of (3R)-3-(4-fluorophenyl)thiolane 1,1-dioxide?
The InChIKey is GZWLOUCRIFEZGT-VIFPVBQESA-N. The full InChI is InChI=1S/C10H11FO2S/c11-10-3-1-8(2-4-10)9-5-6-14(12,13)7-9/h1-4,9H,5-7H2/t9-/m0/s1.
What are the key properties of (3R)-3-(4-fluorophenyl)thiolane 1,1-dioxide?
(3R)-3-(4-fluorophenyl)thiolane 1,1-dioxide has a molecular weight of 214.26 g/mol, XLogP of 1.73, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(4-fluorophenyl)thiolane 1,1-dioxide is sourced from PubChem (CID 134951756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).