C21H35N — CID 134951790
(2R,3S,5S,6R)-2-deca-3,4,9-trienyl-3,5-dimethyl-6-(2-methylprop-2-enyl)piperidine (PubChem CID 134951790) has the molecular formula C21H35N and a molecular weight of 301.52 g/mol. Its IUPAC name is (2R,3S,5S,6R)-2-deca-3,4,9-trienyl-3,5-dimethyl-6-(2-methylprop-2-enyl)piperidine.
| Compound Name | (2R,3S,5S,6R)-2-deca-3,4,9-trienyl-3,5-dimethyl-6-(2-methylprop-2-enyl)piperidine |
|---|---|
| PubChem CID | 134951790 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | (2R,3S,5S,6R)-2-deca-3,4,9-trienyl-3,5-dimethyl-6-(2-methylprop-2-enyl)piperidine |
| SMILES | C=CCCCC=C=CCC[C@H]1N[C@H](CC(=C)C)[C@@H](C)C[C@@H]1C |
| InChI | InChI=1S/C21H35N/c1-6-7-8-9-10-11-12-13-14-20-18(4)16-19(5)21(22-20)15-17(2)3/h6,10,12,18-22H,1-2,7-9,13-16H2,3-5H3/t11?,18-,19-,20+,21+/m0/s1 |
| InChIKey | CKTKATBPDKZYQF-QHFWIAPESA-N |
| XLogP | 5.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|