About [4-[(1S,2S)-2-methylcyclohexyl]phenyl] trifluoromethanesulfonate
[4-[(1S,2S)-2-methylcyclohexyl]phenyl] trifluoromethanesulfonate (PubChem CID 134951814) has the molecular formula C14H17F3O3S
and a molecular weight of 322.35 g/mol. Its IUPAC name is [4-[(1S,2S)-2-methylcyclohexyl]phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4-[(1S,2S)-2-methylcyclohexyl]phenyl] trifluoromethanesulfonate |
| PubChem CID | 134951814 |
| Molecular Formula | C14H17F3O3S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | [4-[(1S,2S)-2-methylcyclohexyl]phenyl] trifluoromethanesulfonate |
| SMILES | C[C@H]1CCCC[C@@H]1c1ccc(OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3O3S/c1-10-4-2-3-5-13(10)11-6-8-12(9-7-11)20-21(18,19)14(15,16)17/h6-10,13H,2-5H2,1H3/t10-,13-/m0/s1 |
| InChIKey | HDXHJGRCWLVDDD-GWCFXTLKSA-N |
| XLogP | 4.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4-[(1S,2S)-2-methylcyclohexyl]phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(1S,2S)-2-methylcyclohexyl]phenyl] trifluoromethanesulfonate?
The IUPAC name of [4-[(1S,2S)-2-methylcyclohexyl]phenyl] trifluoromethanesulfonate (CID 134951814) is [4-[(1S,2S)-2-methylcyclohexyl]phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [4-[(1S,2S)-2-methylcyclohexyl]phenyl] trifluoromethanesulfonate?
The canonical SMILES for [4-[(1S,2S)-2-methylcyclohexyl]phenyl] trifluoromethanesulfonate is C[C@H]1CCCC[C@@H]1c1ccc(OS(=O)(=O)C(F)(F)F)cc1.
What is the InChIKey of [4-[(1S,2S)-2-methylcyclohexyl]phenyl] trifluoromethanesulfonate?
The InChIKey is HDXHJGRCWLVDDD-GWCFXTLKSA-N. The full InChI is InChI=1S/C14H17F3O3S/c1-10-4-2-3-5-13(10)11-6-8-12(9-7-11)20-21(18,19)14(15,16)17/h6-10,13H,2-5H2,1H3/t10-,13-/m0/s1.
What are the key properties of [4-[(1S,2S)-2-methylcyclohexyl]phenyl] trifluoromethanesulfonate?
[4-[(1S,2S)-2-methylcyclohexyl]phenyl] trifluoromethanesulfonate has a molecular weight of 322.35 g/mol, XLogP of 4.21, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(1S,2S)-2-methylcyclohexyl]phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 134951814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).