About (5R,7S)-7-methyl-6-oxaspiro[4.5]decane-4,9-dione
(5R,7S)-7-methyl-6-oxaspiro[4.5]decane-4,9-dione (PubChem CID 134951818) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is (5R,7S)-7-methyl-6-oxaspiro[4.5]decane-4,9-dione.
Molecular Properties
| Compound Name | (5R,7S)-7-methyl-6-oxaspiro[4.5]decane-4,9-dione |
| PubChem CID | 134951818 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (5R,7S)-7-methyl-6-oxaspiro[4.5]decane-4,9-dione |
| SMILES | C[C@H]1CC(=O)C[C@@]2(CCCC2=O)O1 |
| InChI | InChI=1S/C10H14O3/c1-7-5-8(11)6-10(13-7)4-2-3-9(10)12/h7H,2-6H2,1H3/t7-,10+/m0/s1 |
| InChIKey | HRPCGIQAFLAHFX-OIBJUYFYSA-N |
| XLogP | 1.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5R,7S)-7-methyl-6-oxaspiro[4.5]decane-4,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R,7S)-7-methyl-6-oxaspiro[4.5]decane-4,9-dione?
The IUPAC name of (5R,7S)-7-methyl-6-oxaspiro[4.5]decane-4,9-dione (CID 134951818) is (5R,7S)-7-methyl-6-oxaspiro[4.5]decane-4,9-dione.
What is the SMILES notation for (5R,7S)-7-methyl-6-oxaspiro[4.5]decane-4,9-dione?
The canonical SMILES for (5R,7S)-7-methyl-6-oxaspiro[4.5]decane-4,9-dione is C[C@H]1CC(=O)C[C@@]2(CCCC2=O)O1.
What is the InChIKey of (5R,7S)-7-methyl-6-oxaspiro[4.5]decane-4,9-dione?
The InChIKey is HRPCGIQAFLAHFX-OIBJUYFYSA-N. The full InChI is InChI=1S/C10H14O3/c1-7-5-8(11)6-10(13-7)4-2-3-9(10)12/h7H,2-6H2,1H3/t7-,10+/m0/s1.
What are the key properties of (5R,7S)-7-methyl-6-oxaspiro[4.5]decane-4,9-dione?
(5R,7S)-7-methyl-6-oxaspiro[4.5]decane-4,9-dione has a molecular weight of 182.22 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R,7S)-7-methyl-6-oxaspiro[4.5]decane-4,9-dione is sourced from PubChem (CID 134951818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).