C21H35N — CID 134951821
(3R,5R,6S,8S,8aR)-3-[(1E)-hepta-1,6-dienyl]-6,8-dimethyl-5-(2-methylprop-2-enyl)-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 134951821) has the molecular formula C21H35N and a molecular weight of 301.52 g/mol. Its IUPAC name is (3R,5R,6S,8S,8aR)-3-[(1E)-hepta-1,6-dienyl]-6,8-dimethyl-5-(2-methylprop-2-enyl)-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | (3R,5R,6S,8S,8aR)-3-[(1E)-hepta-1,6-dienyl]-6,8-dimethyl-5-(2-methylprop-2-enyl)-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 134951821 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | (3R,5R,6S,8S,8aR)-3-[(1E)-hepta-1,6-dienyl]-6,8-dimethyl-5-(2-methylprop-2-enyl)-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | C=CCCC/C=C/[C@H]1CC[C@@H]2[C@@H](C)C[C@H](C)[C@@H](CC(=C)C)N21 |
| InChI | InChI=1S/C21H35N/c1-6-7-8-9-10-11-19-12-13-20-17(4)15-18(5)21(22(19)20)14-16(2)3/h6,10-11,17-21H,1-2,7-9,12-15H2,3-5H3/b11-10+/t17-,18-,19-,20+,21+/m0/s1 |
| InChIKey | IVOZXSPDTRSGOW-SWMJAAJXSA-N |
| XLogP | 5.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|