C24H16F5N2OP+2 — CID 134951882
5-methyl-11-[(2,3,4,5,6-pentafluorophenyl)methyl]-8-phenyl-5,11-diazonia-8λ5-phosphatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene 8-oxide (PubChem CID 134951882) has the molecular formula C24H16F5N2OP+2 and a molecular weight of 474.37 g/mol. Its IUPAC name is 5-methyl-11-[(2,3,4,5,6-pentafluorophenyl)methyl]-8-phenyl-5,11-diazonia-8λ5-phosphatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene 8-oxide.
| Compound Name | 5-methyl-11-[(2,3,4,5,6-pentafluorophenyl)methyl]-8-phenyl-5,11-diazonia-8λ5-phosphatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene 8-oxide |
|---|---|
| PubChem CID | 134951882 |
| Molecular Formula | C24H16F5N2OP+2 |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 5-methyl-11-[(2,3,4,5,6-pentafluorophenyl)methyl]-8-phenyl-5,11-diazonia-8λ5-phosphatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene 8-oxide |
| SMILES | C[n+]1ccc2c(c1)P(=O)(c1ccccc1)c1c[n+](Cc3c(F)c(F)c(F)c(F)c3F)ccc1-2 |
| InChI | InChI=1S/C24H16F5N2OP/c1-30-9-7-15-16-8-10-31(11-17-20(25)22(27)24(29)23(28)21(17)26)13-19(16)33(32,18(15)12-30)14-5-3-2-4-6-14/h2-10,12-13H,11H2,1H3/q+2 |
| InChIKey | WCTDHCWJNXKXNW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|