C33H21BF15NSi2 — CID 134951968
dimethyl-[6-[methyl-(2,3,4,5,6-pentafluorophenyl)boranyl]-7-(2,3,4,5,6-pentafluorophenyl)-8-trimethylsilylquinolin-5-yl]-(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 134951968) has the molecular formula C33H21BF15NSi2 and a molecular weight of 783.49 g/mol. Its IUPAC name is dimethyl-[6-[methyl-(2,3,4,5,6-pentafluorophenyl)boranyl]-7-(2,3,4,5,6-pentafluorophenyl)-8-trimethylsilylquinolin-5-yl]-(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | dimethyl-[6-[methyl-(2,3,4,5,6-pentafluorophenyl)boranyl]-7-(2,3,4,5,6-pentafluorophenyl)-8-trimethylsilylquinolin-5-yl]-(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 134951968 |
| Molecular Formula | C33H21BF15NSi2 |
| Molecular Weight | 783.49 g/mol |
| Exact Mass | 783.11 |
| IUPAC Name | dimethyl-[6-[methyl-(2,3,4,5,6-pentafluorophenyl)boranyl]-7-(2,3,4,5,6-pentafluorophenyl)-8-trimethylsilylquinolin-5-yl]-(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | CB(c1c(F)c(F)c(F)c(F)c1F)c1c(-c2c(F)c(F)c(F)c(F)c2F)c([Si](C)(C)C)c2ncccc2c1[Si](C)(C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C33H21BF15NSi2/c1-34(14-17(37)21(41)24(44)22(42)18(14)38)13-11(12-15(35)19(39)23(43)20(40)16(12)36)32(51(2,3)4)30-10(8-7-9-50-30)31(13)52(5,6)33-28(48)26(46)25(45)27(47)29(33)49/h7-9H,1-6H3 |
| InChIKey | CGSUDQHHGIFEEG-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.49 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|