C18H28O2 — CID 134951983
(4S,5S)-5-[(E,1S)-1-hydroxydec-2-enyl]-4-prop-1-en-2-ylcyclopent-2-en-1-one (PubChem CID 134951983) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (4S,5S)-5-[(E,1S)-1-hydroxydec-2-enyl]-4-prop-1-en-2-ylcyclopent-2-en-1-one.
| Compound Name | (4S,5S)-5-[(E,1S)-1-hydroxydec-2-enyl]-4-prop-1-en-2-ylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 134951983 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (4S,5S)-5-[(E,1S)-1-hydroxydec-2-enyl]-4-prop-1-en-2-ylcyclopent-2-en-1-one |
| SMILES | C=C(C)[C@H]1C=CC(=O)[C@@H]1[C@@H](O)/C=C/CCCCCCC |
| InChI | InChI=1S/C18H28O2/c1-4-5-6-7-8-9-10-11-16(19)18-15(14(2)3)12-13-17(18)20/h10-13,15-16,18-19H,2,4-9H2,1,3H3/b11-10+/t15-,16+,18+/m1/s1 |
| InChIKey | IRTSUAUXPPKOSB-AAAIWVRRSA-N |
| XLogP | 4.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|