C15H24INO4 — CID 134951988
methyl (1R,4S)-1-(3-iodopropyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-ene-1-carboxylate (PubChem CID 134951988) has the molecular formula C15H24INO4 and a molecular weight of 409.26 g/mol. Its IUPAC name is methyl (1R,4S)-1-(3-iodopropyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-ene-1-carboxylate.
| Compound Name | methyl (1R,4S)-1-(3-iodopropyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 134951988 |
| Molecular Formula | C15H24INO4 |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | methyl (1R,4S)-1-(3-iodopropyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(CCCI)C=C[C@@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H24INO4/c1-14(2,3)21-13(19)17-11-6-8-15(10-11,7-5-9-16)12(18)20-4/h6,8,11H,5,7,9-10H2,1-4H3,(H,17,19)/t11-,15+/m1/s1 |
| InChIKey | FFHKKMOMWFUOEP-ABAIWWIYSA-N |
| XLogP | 3.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|