C29H36F3NO2 — CID 134952005
(2R,5R)-3-benzyl-5-methyl-5-(4-phenylmethoxydec-2-ynyl)-2-(trifluoromethyl)-1,3-oxazolidine (PubChem CID 134952005) has the molecular formula C29H36F3NO2 and a molecular weight of 487.61 g/mol. Its IUPAC name is (2R,5R)-3-benzyl-5-methyl-5-(4-phenylmethoxydec-2-ynyl)-2-(trifluoromethyl)-1,3-oxazolidine.
| Compound Name | (2R,5R)-3-benzyl-5-methyl-5-(4-phenylmethoxydec-2-ynyl)-2-(trifluoromethyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 134952005 |
| Molecular Formula | C29H36F3NO2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | (2R,5R)-3-benzyl-5-methyl-5-(4-phenylmethoxydec-2-ynyl)-2-(trifluoromethyl)-1,3-oxazolidine |
| SMILES | CCCCCCC(C#CC[C@]1(C)CN(Cc2ccccc2)[C@@H](C(F)(F)F)O1)OCc1ccccc1 |
| InChI | InChI=1S/C29H36F3NO2/c1-3-4-5-12-18-26(34-22-25-16-10-7-11-17-25)19-13-20-28(2)23-33(27(35-28)29(30,31)32)21-24-14-8-6-9-15-24/h6-11,14-17,26-27H,3-5,12,18,20-23H2,1-2H3/t26?,27-,28-/m1/s1 |
| InChIKey | QQIUTJPJTJDSQS-DXISBFFWSA-N |
| XLogP | 7.12 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|