About (2R,5R)-3-benzyl-2-(trifluoromethyl)-5-[2-(trifluoromethyl)prop-2-enyl]-1,3-oxazolidine
(2R,5R)-3-benzyl-2-(trifluoromethyl)-5-[2-(trifluoromethyl)prop-2-enyl]-1,3-oxazolidine (PubChem CID 134952006) has the molecular formula C15H15F6NO
and a molecular weight of 339.28 g/mol. Its IUPAC name is (2R,5R)-3-benzyl-2-(trifluoromethyl)-5-[2-(trifluoromethyl)prop-2-enyl]-1,3-oxazolidine.
Molecular Properties
| Compound Name | (2R,5R)-3-benzyl-2-(trifluoromethyl)-5-[2-(trifluoromethyl)prop-2-enyl]-1,3-oxazolidine |
| PubChem CID | 134952006 |
| Molecular Formula | C15H15F6NO |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (2R,5R)-3-benzyl-2-(trifluoromethyl)-5-[2-(trifluoromethyl)prop-2-enyl]-1,3-oxazolidine |
| SMILES | C=C(C[C@@H]1CN(Cc2ccccc2)[C@@H](C(F)(F)F)O1)C(F)(F)F |
| InChI | InChI=1S/C15H15F6NO/c1-10(14(16,17)18)7-12-9-22(13(23-12)15(19,20)21)8-11-5-3-2-4-6-11/h2-6,12-13H,1,7-9H2/t12-,13-/m1/s1 |
| InChIKey | HIPWHHICBFSUDK-CHWSQXEVSA-N |
| XLogP | 4.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,5R)-3-benzyl-2-(trifluoromethyl)-5-[2-(trifluoromethyl)prop-2-enyl]-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-3-benzyl-2-(trifluoromethyl)-5-[2-(trifluoromethyl)prop-2-enyl]-1,3-oxazolidine?
The IUPAC name of (2R,5R)-3-benzyl-2-(trifluoromethyl)-5-[2-(trifluoromethyl)prop-2-enyl]-1,3-oxazolidine (CID 134952006) is (2R,5R)-3-benzyl-2-(trifluoromethyl)-5-[2-(trifluoromethyl)prop-2-enyl]-1,3-oxazolidine.
What is the SMILES notation for (2R,5R)-3-benzyl-2-(trifluoromethyl)-5-[2-(trifluoromethyl)prop-2-enyl]-1,3-oxazolidine?
The canonical SMILES for (2R,5R)-3-benzyl-2-(trifluoromethyl)-5-[2-(trifluoromethyl)prop-2-enyl]-1,3-oxazolidine is C=C(C[C@@H]1CN(Cc2ccccc2)[C@@H](C(F)(F)F)O1)C(F)(F)F.
What is the InChIKey of (2R,5R)-3-benzyl-2-(trifluoromethyl)-5-[2-(trifluoromethyl)prop-2-enyl]-1,3-oxazolidine?
The InChIKey is HIPWHHICBFSUDK-CHWSQXEVSA-N. The full InChI is InChI=1S/C15H15F6NO/c1-10(14(16,17)18)7-12-9-22(13(23-12)15(19,20)21)8-11-5-3-2-4-6-11/h2-6,12-13H,1,7-9H2/t12-,13-/m1/s1.
What are the key properties of (2R,5R)-3-benzyl-2-(trifluoromethyl)-5-[2-(trifluoromethyl)prop-2-enyl]-1,3-oxazolidine?
(2R,5R)-3-benzyl-2-(trifluoromethyl)-5-[2-(trifluoromethyl)prop-2-enyl]-1,3-oxazolidine has a molecular weight of 339.28 g/mol, XLogP of 4.28, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-3-benzyl-2-(trifluoromethyl)-5-[2-(trifluoromethyl)prop-2-enyl]-1,3-oxazolidine is sourced from PubChem (CID 134952006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).