C19H23NO5 — CID 134952030
1-O-benzyl 2-O-ethyl (2R,3aR,7aR)-5-oxo-3,3a,4,6,7,7a-hexahydro-2H-indole-1,2-dicarboxylate (PubChem CID 134952030) has the molecular formula C19H23NO5 and a molecular weight of 345.39 g/mol. Its IUPAC name is 1-O-benzyl 2-O-ethyl (2R,3aR,7aR)-5-oxo-3,3a,4,6,7,7a-hexahydro-2H-indole-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-ethyl (2R,3aR,7aR)-5-oxo-3,3a,4,6,7,7a-hexahydro-2H-indole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134952030 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1-O-benzyl 2-O-ethyl (2R,3aR,7aR)-5-oxo-3,3a,4,6,7,7a-hexahydro-2H-indole-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H]2CC(=O)CC[C@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H23NO5/c1-2-24-18(22)17-11-14-10-15(21)8-9-16(14)20(17)19(23)25-12-13-6-4-3-5-7-13/h3-7,14,16-17H,2,8-12H2,1H3/t14-,16+,17+/m0/s1 |
| InChIKey | AAJAJRQPGJOBLC-USXIJHARSA-N |
| XLogP | 2.70 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |