C15H22O — CID 134952393
(1R,3aR,6aS,10aS)-1-ethyl-2,3,3a,6,6a,8,9,10-octahydro-1H-cyclopenta[e]naphthalen-7-one (PubChem CID 134952393) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (1R,3aR,6aS,10aS)-1-ethyl-2,3,3a,6,6a,8,9,10-octahydro-1H-cyclopenta[e]naphthalen-7-one.
| Compound Name | (1R,3aR,6aS,10aS)-1-ethyl-2,3,3a,6,6a,8,9,10-octahydro-1H-cyclopenta[e]naphthalen-7-one |
|---|---|
| PubChem CID | 134952393 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (1R,3aR,6aS,10aS)-1-ethyl-2,3,3a,6,6a,8,9,10-octahydro-1H-cyclopenta[e]naphthalen-7-one |
| SMILES | CC[C@@H]1CC[C@@H]2C=CC[C@@H]3C(=O)CCC[C@@]132 |
| InChI | InChI=1S/C15H22O/c1-2-11-8-9-12-5-3-6-13-14(16)7-4-10-15(11,12)13/h3,5,11-13H,2,4,6-10H2,1H3/t11-,12+,13-,15+/m1/s1 |
| InChIKey | MXXHWWLXXORRID-COMQUAJESA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|