C13H24FNO5S — CID 134952407
tert-butyl (4R,5S)-4-[(1R,2R)-2-fluoro-1,3-dihydroxypropyl]-5-hydroxy-2,2-dimethyl-1,3-thiazolidine-3-carboxylate (PubChem CID 134952407) has the molecular formula C13H24FNO5S and a molecular weight of 325.40 g/mol. Its IUPAC name is tert-butyl (4R,5S)-4-[(1R,2R)-2-fluoro-1,3-dihydroxypropyl]-5-hydroxy-2,2-dimethyl-1,3-thiazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R,5S)-4-[(1R,2R)-2-fluoro-1,3-dihydroxypropyl]-5-hydroxy-2,2-dimethyl-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134952407 |
| Molecular Formula | C13H24FNO5S |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | tert-butyl (4R,5S)-4-[(1R,2R)-2-fluoro-1,3-dihydroxypropyl]-5-hydroxy-2,2-dimethyl-1,3-thiazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]([C@@H](O)[C@H](F)CO)[C@@H](O)SC1(C)C |
| InChI | InChI=1S/C13H24FNO5S/c1-12(2,3)20-11(19)15-8(9(17)7(14)6-16)10(18)21-13(15,4)5/h7-10,16-18H,6H2,1-5H3/t7-,8-,9+,10+/m1/s1 |
| InChIKey | GTHKKGKLQHYGSR-IMSYWVGJSA-N |
| XLogP | 1.08 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |