C17H24O6 — CID 134952521
3-O,3-O'-diethyl 8-O-methyl (1R,8S)-5-methylbicyclo[4.2.0]oct-5-ene-3,3,8-tricarboxylate (PubChem CID 134952521) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is 3-O,3-O'-diethyl 8-O-methyl (1R,8S)-5-methylbicyclo[4.2.0]oct-5-ene-3,3,8-tricarboxylate.
| Compound Name | 3-O,3-O'-diethyl 8-O-methyl (1R,8S)-5-methylbicyclo[4.2.0]oct-5-ene-3,3,8-tricarboxylate |
|---|---|
| PubChem CID | 134952521 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 3-O,3-O'-diethyl 8-O-methyl (1R,8S)-5-methylbicyclo[4.2.0]oct-5-ene-3,3,8-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(C)=C2C[C@H](C(=O)OC)[C@H]2C1 |
| InChI | InChI=1S/C17H24O6/c1-5-22-15(19)17(16(20)23-6-2)8-10(3)11-7-12(13(11)9-17)14(18)21-4/h12-13H,5-9H2,1-4H3/t12-,13-/m0/s1 |
| InChIKey | OAEFNLRBYPGTPO-STQMWFEESA-N |
| XLogP | 2.02 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|