C11H20O4 — CID 134952784
methyl (2S,3R)-3-cyclohexyl-3-hydroxy-2-methoxypropanoate (PubChem CID 134952784) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is methyl (2S,3R)-3-cyclohexyl-3-hydroxy-2-methoxypropanoate.
| Compound Name | methyl (2S,3R)-3-cyclohexyl-3-hydroxy-2-methoxypropanoate |
|---|---|
| PubChem CID | 134952784 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | methyl (2S,3R)-3-cyclohexyl-3-hydroxy-2-methoxypropanoate |
| SMILES | COC(=O)[C@@H](OC)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C11H20O4/c1-14-10(11(13)15-2)9(12)8-6-4-3-5-7-8/h8-10,12H,3-7H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | WVLXLHPVFYLSMT-ZJUUUORDSA-N |
| XLogP | 1.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |