C17H12Cl2O2 — CID 134952815
3'-(2,4-dichlorophenyl)spiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one (PubChem CID 134952815) has the molecular formula C17H12Cl2O2 and a molecular weight of 319.19 g/mol. Its IUPAC name is 3'-(2,4-dichlorophenyl)spiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one.
| Compound Name | 3'-(2,4-dichlorophenyl)spiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one |
|---|---|
| PubChem CID | 134952815 |
| Molecular Formula | C17H12Cl2O2 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 3'-(2,4-dichlorophenyl)spiro[3,4-dihydronaphthalene-2,2'-oxirane]-1-one |
| SMILES | O=C1c2ccccc2CCC12OC2c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H12Cl2O2/c18-11-5-6-13(14(19)9-11)16-17(21-16)8-7-10-3-1-2-4-12(10)15(17)20/h1-6,9,16H,7-8H2 |
| InChIKey | YTWRKLBRAJJJNY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|