C15H18O5 — CID 134952915
(1S,2S,6S,15R)-2,15-dimethyl-4,12-dioxatetracyclo[7.3.3.01,9.02,6]pentadecane-5,7,11-trione (PubChem CID 134952915) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (1S,2S,6S,15R)-2,15-dimethyl-4,12-dioxatetracyclo[7.3.3.01,9.02,6]pentadecane-5,7,11-trione.
| Compound Name | (1S,2S,6S,15R)-2,15-dimethyl-4,12-dioxatetracyclo[7.3.3.01,9.02,6]pentadecane-5,7,11-trione |
|---|---|
| PubChem CID | 134952915 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (1S,2S,6S,15R)-2,15-dimethyl-4,12-dioxatetracyclo[7.3.3.01,9.02,6]pentadecane-5,7,11-trione |
| SMILES | C[C@@H]1CC[C@]23OC(=O)CC12CC(=O)[C@H]1C(=O)OC[C@]13C |
| InChI | InChI=1S/C15H18O5/c1-8-3-4-15-13(2)7-19-12(18)11(13)9(16)5-14(8,15)6-10(17)20-15/h8,11H,3-7H2,1-2H3/t8-,11+,13-,14?,15-/m1/s1 |
| InChIKey | PSUIRUALYAXHFW-ZIXJSATOSA-N |
| XLogP | 1.24 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|