C15H18O6 — CID 134952916
(1S,2R,6R,15R)-6-hydroxy-2,15-dimethyl-4,12-dioxatetracyclo[7.3.3.01,9.02,6]pentadecane-5,7,11-trione (PubChem CID 134952916) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is (1S,2R,6R,15R)-6-hydroxy-2,15-dimethyl-4,12-dioxatetracyclo[7.3.3.01,9.02,6]pentadecane-5,7,11-trione.
| Compound Name | (1S,2R,6R,15R)-6-hydroxy-2,15-dimethyl-4,12-dioxatetracyclo[7.3.3.01,9.02,6]pentadecane-5,7,11-trione |
|---|---|
| PubChem CID | 134952916 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (1S,2R,6R,15R)-6-hydroxy-2,15-dimethyl-4,12-dioxatetracyclo[7.3.3.01,9.02,6]pentadecane-5,7,11-trione |
| SMILES | C[C@@H]1CC[C@]23OC(=O)CC12CC(=O)[C@@]1(O)C(=O)OC[C@]13C |
| InChI | InChI=1S/C15H18O6/c1-8-3-4-14-12(2)7-20-11(18)15(12,19)9(16)5-13(8,14)6-10(17)21-14/h8,19H,3-7H2,1-2H3/t8-,12+,13?,14-,15-/m1/s1 |
| InChIKey | WKVRCQMGGUTPCD-AAMBSQIPSA-N |
| XLogP | 0.36 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|