About CID 134952958
CID 134952958 (PubChem CID 134952958) has the molecular formula C22H26BNO2P+
and a molecular weight of 378.24 g/mol.
Molecular Properties
| Compound Name | CID 134952958 |
| PubChem CID | 134952958 |
| Molecular Formula | C22H26BNO2P+ |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | — |
| SMILES | [B][P+](C[C@@H]1C=CCN1C(=O)OC(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H26BNO2P/c1-22(2,3)26-21(25)24-16-10-11-18(24)17-27(23,19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-15,18H,16-17H2,1-3H3/q+1/t18-/m0/s1 |
| InChIKey | WBGBPZDVUNAHHS-SFHVURJKSA-N |
| XLogP | 3.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 134952958 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134952958?
The IUPAC name of CID 134952958 (CID 134952958) is not available.
What is the SMILES notation for CID 134952958?
The canonical SMILES for CID 134952958 is [B][P+](C[C@@H]1C=CCN1C(=O)OC(C)(C)C)(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 134952958?
The InChIKey is WBGBPZDVUNAHHS-SFHVURJKSA-N. The full InChI is InChI=1S/C22H26BNO2P/c1-22(2,3)26-21(25)24-16-10-11-18(24)17-27(23,19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-15,18H,16-17H2,1-3H3/q+1/t18-/m0/s1.
What are the key properties of CID 134952958?
CID 134952958 has a molecular weight of 378.24 g/mol, XLogP of 3.91, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134952958 is sourced from PubChem (CID 134952958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).