C21H39BrOSi — CID 134953040
[(7E,11E)-13-bromo-7,11-dimethyltrideca-1,7,11-trien-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134953040) has the molecular formula C21H39BrOSi and a molecular weight of 415.53 g/mol. Its IUPAC name is [(7E,11E)-13-bromo-7,11-dimethyltrideca-1,7,11-trien-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(7E,11E)-13-bromo-7,11-dimethyltrideca-1,7,11-trien-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134953040 |
| Molecular Formula | C21H39BrOSi |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | [(7E,11E)-13-bromo-7,11-dimethyltrideca-1,7,11-trien-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CC(CCC/C(C)=C/CC/C(C)=C/CBr)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H39BrOSi/c1-9-20(23-24(7,8)21(4,5)6)15-11-14-18(2)12-10-13-19(3)16-17-22/h9,12,16,20H,1,10-11,13-15,17H2,2-8H3/b18-12+,19-16+ |
| InChIKey | XOMXNARZEYZURZ-WBLKYFKXSA-N |
| XLogP | 7.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|