C22H28N2O — CID 134953074
[(1R,3R,4R,5S)-2,7-dimethyl-1,4-diphenyl-2,7-diazaspiro[4.4]nonan-3-yl]methanol (PubChem CID 134953074) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is [(1R,3R,4R,5S)-2,7-dimethyl-1,4-diphenyl-2,7-diazaspiro[4.4]nonan-3-yl]methanol.
| Compound Name | [(1R,3R,4R,5S)-2,7-dimethyl-1,4-diphenyl-2,7-diazaspiro[4.4]nonan-3-yl]methanol |
|---|---|
| PubChem CID | 134953074 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | [(1R,3R,4R,5S)-2,7-dimethyl-1,4-diphenyl-2,7-diazaspiro[4.4]nonan-3-yl]methanol |
| SMILES | CN1CC[C@@]2(C1)[C@@H](c1ccccc1)[C@H](CO)N(C)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C22H28N2O/c1-23-14-13-22(16-23)20(17-9-5-3-6-10-17)19(15-25)24(2)21(22)18-11-7-4-8-12-18/h3-12,19-21,25H,13-16H2,1-2H3/t19-,20-,21+,22+/m0/s1 |
| InChIKey | JWXHYIFEGYYCRV-FNAHDJPLSA-N |
| XLogP | 3.14 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |