C20H24O2 — CID 134953143
(1S,1aR,1bR,5aS,6aS)-6-methylidene-1-(4-methylphenyl)spiro[1,1a,1b,2,4,5,5a,6a-octahydrocyclopropa[a]indene-3,2'-1,3-dioxolane] (PubChem CID 134953143) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (1S,1aR,1bR,5aS,6aS)-6-methylidene-1-(4-methylphenyl)spiro[1,1a,1b,2,4,5,5a,6a-octahydrocyclopropa[a]indene-3,2'-1,3-dioxolane].
| Compound Name | (1S,1aR,1bR,5aS,6aS)-6-methylidene-1-(4-methylphenyl)spiro[1,1a,1b,2,4,5,5a,6a-octahydrocyclopropa[a]indene-3,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 134953143 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (1S,1aR,1bR,5aS,6aS)-6-methylidene-1-(4-methylphenyl)spiro[1,1a,1b,2,4,5,5a,6a-octahydrocyclopropa[a]indene-3,2'-1,3-dioxolane] |
| SMILES | C=C1[C@@H]2[C@@H](c3ccc(C)cc3)[C@@H]2[C@H]2CC3(CC[C@H]12)OCCO3 |
| InChI | InChI=1S/C20H24O2/c1-12-3-5-14(6-4-12)18-17-13(2)15-7-8-20(21-9-10-22-20)11-16(15)19(17)18/h3-6,15-19H,2,7-11H2,1H3/t15-,16+,17-,18-,19-/m1/s1 |
| InChIKey | BCXJBTIJIVSDMR-RHQZKXFESA-N |
| XLogP | 4.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|