C20H37IO2Si — CID 134953226
(1E,3R,4S,5E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-1-iodo-2,6-dimethyldeca-1,5,9-trien-3-ol (PubChem CID 134953226) has the molecular formula C20H37IO2Si and a molecular weight of 464.50 g/mol. Its IUPAC name is (1E,3R,4S,5E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-1-iodo-2,6-dimethyldeca-1,5,9-trien-3-ol.
| Compound Name | (1E,3R,4S,5E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-1-iodo-2,6-dimethyldeca-1,5,9-trien-3-ol |
|---|---|
| PubChem CID | 134953226 |
| Molecular Formula | C20H37IO2Si |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | (1E,3R,4S,5E,7S)-7-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-1-iodo-2,6-dimethyldeca-1,5,9-trien-3-ol |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@H](CC)[C@@H](O)/C(C)=C/I |
| InChI | InChI=1S/C20H37IO2Si/c1-10-12-18(23-24(8,9)20(5,6)7)15(3)13-17(11-2)19(22)16(4)14-21/h10,13-14,17-19,22H,1,11-12H2,2-9H3/b15-13+,16-14+/t17-,18-,19-/m0/s1 |
| InChIKey | OTNRLNHQEQOWJW-FPPKPYSGSA-N |
| XLogP | 6.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|