C31H42O7 — CID 134953348
ethyl (2Z,4E,6R)-6-[(1S,3R,7R,10S,13S,17S,18R)-1-hydroxy-9,9,18-trimethyl-5,16-dioxo-4,8-dioxapentacyclo[11.7.0.03,7.03,10.014,18]icos-14-en-17-yl]-2-methylhepta-2,4-dienoate (PubChem CID 134953348) has the molecular formula C31H42O7 and a molecular weight of 526.67 g/mol. Its IUPAC name is ethyl (2Z,4E,6R)-6-[(1S,3R,7R,10S,13S,17S,18R)-1-hydroxy-9,9,18-trimethyl-5,16-dioxo-4,8-dioxapentacyclo[11.7.0.03,7.03,10.014,18]icos-14-en-17-yl]-2-methylhepta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E,6R)-6-[(1S,3R,7R,10S,13S,17S,18R)-1-hydroxy-9,9,18-trimethyl-5,16-dioxo-4,8-dioxapentacyclo[11.7.0.03,7.03,10.014,18]icos-14-en-17-yl]-2-methylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 134953348 |
| Molecular Formula | C31H42O7 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | ethyl (2Z,4E,6R)-6-[(1S,3R,7R,10S,13S,17S,18R)-1-hydroxy-9,9,18-trimethyl-5,16-dioxo-4,8-dioxapentacyclo[11.7.0.03,7.03,10.014,18]icos-14-en-17-yl]-2-methylhepta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C\C=C\[C@@H](C)[C@@H]1C(=O)C=C2[C@@H]3CC[C@H]4C(C)(C)O[C@@H]5CC(=O)O[C@@]54C[C@@]3(O)CC[C@@]21C |
| InChI | InChI=1S/C31H42O7/c1-7-36-27(34)19(3)10-8-9-18(2)26-22(32)15-21-20-11-12-23-28(4,5)37-24-16-25(33)38-31(23,24)17-30(20,35)14-13-29(21,26)6/h8-10,15,18,20,23-24,26,35H,7,11-14,16-17H2,1-6H3/b9-8+,19-10-/t18-,20+,23+,24-,26-,29+,30+,31-/m1/s1 |
| InChIKey | GDSLUTSMIVHETB-BQETYLSQSA-N |
| XLogP | 4.62 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|