C17H17NOS — CID 134953386
(3aS,8bR)-8b-[(1R)-1-thiophen-2-ylprop-2-enyl]-1,2,3a,4-tetrahydrofuro[2,3-b]indole (PubChem CID 134953386) has the molecular formula C17H17NOS and a molecular weight of 283.40 g/mol. Its IUPAC name is (3aS,8bR)-8b-[(1R)-1-thiophen-2-ylprop-2-enyl]-1,2,3a,4-tetrahydrofuro[2,3-b]indole.
| Compound Name | (3aS,8bR)-8b-[(1R)-1-thiophen-2-ylprop-2-enyl]-1,2,3a,4-tetrahydrofuro[2,3-b]indole |
|---|---|
| PubChem CID | 134953386 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (3aS,8bR)-8b-[(1R)-1-thiophen-2-ylprop-2-enyl]-1,2,3a,4-tetrahydrofuro[2,3-b]indole |
| SMILES | C=C[C@@H](c1cccs1)[C@@]12CCO[C@@H]1Nc1ccccc12 |
| InChI | InChI=1S/C17H17NOS/c1-2-12(15-8-5-11-20-15)17-9-10-19-16(17)18-14-7-4-3-6-13(14)17/h2-8,11-12,16,18H,1,9-10H2/t12-,16-,17+/m0/s1 |
| InChIKey | ONIPBPNJBGEDLY-AFAVFJNCSA-N |
| XLogP | 4.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|