C22H32O3Si — CID 134953419
6-hydroxy-5,5,9-trimethyl-16-trimethylsilyltetracyclo[10.2.2.01,10.04,9]hexadeca-10,15-diene-13,14-dione (PubChem CID 134953419) has the molecular formula C22H32O3Si and a molecular weight of 372.58 g/mol. Its IUPAC name is 6-hydroxy-5,5,9-trimethyl-16-trimethylsilyltetracyclo[10.2.2.01,10.04,9]hexadeca-10,15-diene-13,14-dione.
| Compound Name | 6-hydroxy-5,5,9-trimethyl-16-trimethylsilyltetracyclo[10.2.2.01,10.04,9]hexadeca-10,15-diene-13,14-dione |
|---|---|
| PubChem CID | 134953419 |
| Molecular Formula | C22H32O3Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 6-hydroxy-5,5,9-trimethyl-16-trimethylsilyltetracyclo[10.2.2.01,10.04,9]hexadeca-10,15-diene-13,14-dione |
| SMILES | CC12CCC(O)C(C)(C)C1CCC13C=C([Si](C)(C)C)C(C=C12)C(=O)C3=O |
| InChI | InChI=1S/C22H32O3Si/c1-20(2)15-7-10-22-12-14(26(4,5)6)13(18(24)19(22)25)11-16(22)21(15,3)9-8-17(20)23/h11-13,15,17,23H,7-10H2,1-6H3 |
| InChIKey | VLXHAHFQZDLHIX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|