C17H27IO2 — CID 134953659
[(1R,5R)-5-[(Z)-2-iodoethenyl]cyclohex-2-en-1-yl] (6S)-6-methyloctanoate (PubChem CID 134953659) has the molecular formula C17H27IO2 and a molecular weight of 390.31 g/mol. Its IUPAC name is [(1R,5R)-5-[(Z)-2-iodoethenyl]cyclohex-2-en-1-yl] (6S)-6-methyloctanoate.
| Compound Name | [(1R,5R)-5-[(Z)-2-iodoethenyl]cyclohex-2-en-1-yl] (6S)-6-methyloctanoate |
|---|---|
| PubChem CID | 134953659 |
| Molecular Formula | C17H27IO2 |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | [(1R,5R)-5-[(Z)-2-iodoethenyl]cyclohex-2-en-1-yl] (6S)-6-methyloctanoate |
| SMILES | CC[C@H](C)CCCCC(=O)O[C@H]1C=CC[C@@H](/C=C\I)C1 |
| InChI | InChI=1S/C17H27IO2/c1-3-14(2)7-4-5-10-17(19)20-16-9-6-8-15(13-16)11-12-18/h6,9,11-12,14-16H,3-5,7-8,10,13H2,1-2H3/b12-11-/t14-,15-,16-/m0/s1 |
| InChIKey | ASAMSZVWDBMHDC-CUIUTGPMSA-N |
| XLogP | 5.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|