C26H40O3 — CID 134953741
(1R,2S,3aS,7aS)-7a-hydroxy-1-methyl-2,3a-bis(3-methylbut-2-enyl)-1-(4-methylpent-3-enyl)-3,7-dihydro-2H-indene-4,6-dione (PubChem CID 134953741) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is (1R,2S,3aS,7aS)-7a-hydroxy-1-methyl-2,3a-bis(3-methylbut-2-enyl)-1-(4-methylpent-3-enyl)-3,7-dihydro-2H-indene-4,6-dione.
| Compound Name | (1R,2S,3aS,7aS)-7a-hydroxy-1-methyl-2,3a-bis(3-methylbut-2-enyl)-1-(4-methylpent-3-enyl)-3,7-dihydro-2H-indene-4,6-dione |
|---|---|
| PubChem CID | 134953741 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | (1R,2S,3aS,7aS)-7a-hydroxy-1-methyl-2,3a-bis(3-methylbut-2-enyl)-1-(4-methylpent-3-enyl)-3,7-dihydro-2H-indene-4,6-dione |
| SMILES | CC(C)=CCC[C@]1(C)[C@@H](CC=C(C)C)C[C@]2(CC=C(C)C)C(=O)CC(=O)C[C@@]21O |
| InChI | InChI=1S/C26H40O3/c1-18(2)9-8-13-24(7)21(11-10-19(3)4)16-25(14-12-20(5)6)23(28)15-22(27)17-26(24,25)29/h9-10,12,21,29H,8,11,13-17H2,1-7H3/t21-,24+,25+,26-/m0/s1 |
| InChIKey | DCKHQZXVAXOIHB-WSZJRCBQSA-N |
| XLogP | 6.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|