C18H18O8 — CID 134953777
(1R,2R,7S,8S)-8-hydroxy-2-(hydroxymethyl)-4-methoxy-3,10-dimethyl-13-oxatetracyclo[6.6.1.01,11.02,7]pentadeca-3,10-diene-5,6,9,15-tetrone (PubChem CID 134953777) has the molecular formula C18H18O8 and a molecular weight of 362.33 g/mol. Its IUPAC name is (1R,2R,7S,8S)-8-hydroxy-2-(hydroxymethyl)-4-methoxy-3,10-dimethyl-13-oxatetracyclo[6.6.1.01,11.02,7]pentadeca-3,10-diene-5,6,9,15-tetrone.
| Compound Name | (1R,2R,7S,8S)-8-hydroxy-2-(hydroxymethyl)-4-methoxy-3,10-dimethyl-13-oxatetracyclo[6.6.1.01,11.02,7]pentadeca-3,10-diene-5,6,9,15-tetrone |
|---|---|
| PubChem CID | 134953777 |
| Molecular Formula | C18H18O8 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (1R,2R,7S,8S)-8-hydroxy-2-(hydroxymethyl)-4-methoxy-3,10-dimethyl-13-oxatetracyclo[6.6.1.01,11.02,7]pentadeca-3,10-diene-5,6,9,15-tetrone |
| SMILES | COC1=C(C)[C@]2(CO)[C@H](C(=O)C1=O)[C@]1(O)C(=O)C(C)=C3COC[C@@]32C1=O |
| InChI | InChI=1S/C18H18O8/c1-7-9-4-26-6-17(9)15(23)18(24,14(7)22)13-11(21)10(20)12(25-3)8(2)16(13,17)5-19/h13,19,24H,4-6H2,1-3H3/t13-,16+,17-,18-/m0/s1 |
| InChIKey | CVHDSCKTZUKXAD-NBMRYCAZSA-N |
| XLogP | -1.12 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|