C10H15IO2 — CID 134953870
(2R,3S,6R)-3-ethyl-2-[(E)-2-iodoethenyl]-6-methoxy-3,6-dihydro-2H-pyran (PubChem CID 134953870) has the molecular formula C10H15IO2 and a molecular weight of 294.13 g/mol. Its IUPAC name is (2R,3S,6R)-3-ethyl-2-[(E)-2-iodoethenyl]-6-methoxy-3,6-dihydro-2H-pyran.
| Compound Name | (2R,3S,6R)-3-ethyl-2-[(E)-2-iodoethenyl]-6-methoxy-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 134953870 |
| Molecular Formula | C10H15IO2 |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | (2R,3S,6R)-3-ethyl-2-[(E)-2-iodoethenyl]-6-methoxy-3,6-dihydro-2H-pyran |
| SMILES | CC[C@H]1C=C[C@H](OC)O[C@H]1/C=C/I |
| InChI | InChI=1S/C10H15IO2/c1-3-8-4-5-10(12-2)13-9(8)6-7-11/h4-10H,3H2,1-2H3/b7-6+/t8-,9-,10+/m0/s1 |
| InChIKey | CKAWQHVVADQHSH-PUAHGDKPSA-N |
| XLogP | 2.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|