C12H9F3N2O3S2 — CID 134954003
(3S)-4,4,4-trifluoro-3-(nitromethyl)-1-(1,3-thiazol-2-yl)-3-thiophen-2-ylbutan-1-one (PubChem CID 134954003) has the molecular formula C12H9F3N2O3S2 and a molecular weight of 350.34 g/mol. Its IUPAC name is (3S)-4,4,4-trifluoro-3-(nitromethyl)-1-(1,3-thiazol-2-yl)-3-thiophen-2-ylbutan-1-one.
| Compound Name | (3S)-4,4,4-trifluoro-3-(nitromethyl)-1-(1,3-thiazol-2-yl)-3-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 134954003 |
| Molecular Formula | C12H9F3N2O3S2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | (3S)-4,4,4-trifluoro-3-(nitromethyl)-1-(1,3-thiazol-2-yl)-3-thiophen-2-ylbutan-1-one |
| SMILES | O=C(C[C@@](C[N+](=O)[O-])(c1cccs1)C(F)(F)F)c1nccs1 |
| InChI | InChI=1S/C12H9F3N2O3S2/c13-12(14,15)11(7-17(19)20,9-2-1-4-21-9)6-8(18)10-16-3-5-22-10/h1-5H,6-7H2/t11-/m1/s1 |
| InChIKey | XCXBSZJYQRKJRU-LLVKDONJSA-N |
| XLogP | 3.55 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|