C29H28F6N4O — CID 134954021
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1R)-2-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-1-quinolin-4-ylethyl]urea (PubChem CID 134954021) has the molecular formula C29H28F6N4O and a molecular weight of 562.56 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1R)-2-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-1-quinolin-4-ylethyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1R)-2-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-1-quinolin-4-ylethyl]urea |
|---|---|
| PubChem CID | 134954021 |
| Molecular Formula | C29H28F6N4O |
| Molecular Weight | 562.56 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1R)-2-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-1-quinolin-4-ylethyl]urea |
| SMILES | C=CC1CN2CCC1CC2C[C@@H](NC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C29H28F6N4O/c1-2-17-16-39-10-8-18(17)11-22(39)15-26(24-7-9-36-25-6-4-3-5-23(24)25)38-27(40)37-21-13-19(28(30,31)32)12-20(14-21)29(33,34)35/h2-7,9,12-14,17-18,22,26H,1,8,10-11,15-16H2,(H2,37,38,40)/t17?,18?,22?,26-/m1/s1 |
| InChIKey | MFNUWNIBWYFZSO-FQPGAFQESA-N |
| XLogP | 7.42 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.56 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|