C22H23NO4S — CID 134954028
methyl (1S,3R,3aS,5R,6aR)-5-benzyl-3,5-dimethyl-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydrocyclopenta[c]pyrrole-3-carboxylate (PubChem CID 134954028) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is methyl (1S,3R,3aS,5R,6aR)-5-benzyl-3,5-dimethyl-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydrocyclopenta[c]pyrrole-3-carboxylate.
| Compound Name | methyl (1S,3R,3aS,5R,6aR)-5-benzyl-3,5-dimethyl-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydrocyclopenta[c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 134954028 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | methyl (1S,3R,3aS,5R,6aR)-5-benzyl-3,5-dimethyl-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydrocyclopenta[c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@]1(C)N[C@H](c2cccs2)[C@@H]2C(=O)[C@@](C)(Cc3ccccc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C22H23NO4S/c1-21(12-13-8-5-4-6-9-13)18(24)15-16(19(21)25)22(2,20(26)27-3)23-17(15)14-10-7-11-28-14/h4-11,15-17,23H,12H2,1-3H3/t15-,16-,17-,21-,22-/m1/s1 |
| InChIKey | QIBCQHZSQNYTDL-IYTCPKSSSA-N |
| XLogP | 2.96 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|