C32H26NOP — CID 134954356
[(5Z)-5-[(4R,5R)-4,5-diphenyl-1,3-oxazolidin-2-ylidene]cyclopenta-1,3-dien-1-yl]-diphenylphosphane (PubChem CID 134954356) has the molecular formula C32H26NOP and a molecular weight of 471.54 g/mol. Its IUPAC name is [(5Z)-5-[(4R,5R)-4,5-diphenyl-1,3-oxazolidin-2-ylidene]cyclopenta-1,3-dien-1-yl]-diphenylphosphane.
| Compound Name | [(5Z)-5-[(4R,5R)-4,5-diphenyl-1,3-oxazolidin-2-ylidene]cyclopenta-1,3-dien-1-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 134954356 |
| Molecular Formula | C32H26NOP |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | [(5Z)-5-[(4R,5R)-4,5-diphenyl-1,3-oxazolidin-2-ylidene]cyclopenta-1,3-dien-1-yl]-diphenylphosphane |
| SMILES | C1=C/C(=C2\N[C@H](c3ccccc3)[C@@H](c3ccccc3)O2)C(P(c2ccccc2)c2ccccc2)=C1 |
| InChI | InChI=1S/C32H26NOP/c1-5-14-24(15-6-1)30-31(25-16-7-2-8-17-25)34-32(33-30)28-22-13-23-29(28)35(26-18-9-3-10-19-26)27-20-11-4-12-21-27/h1-23,30-31,33H/b32-28-/t30-,31-/m1/s1 |
| InChIKey | KFUZXNNAVQQHPQ-JKKLPUHPSA-N |
| XLogP | 6.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|