C18H24O6Si — CID 134954411
(2S)-2,6-dimethyl-10-trimethylsilyloxy-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-3,9,13-trione (PubChem CID 134954411) has the molecular formula C18H24O6Si and a molecular weight of 364.47 g/mol. Its IUPAC name is (2S)-2,6-dimethyl-10-trimethylsilyloxy-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-3,9,13-trione.
| Compound Name | (2S)-2,6-dimethyl-10-trimethylsilyloxy-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-3,9,13-trione |
|---|---|
| PubChem CID | 134954411 |
| Molecular Formula | C18H24O6Si |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (2S)-2,6-dimethyl-10-trimethylsilyloxy-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadec-4-ene-3,9,13-trione |
| SMILES | C[C@@H]1C(=O)C=C2C13CC(=O)OC(C3)C1(O[Si](C)(C)C)C(=O)OCC21C |
| InChI | InChI=1S/C18H24O6Si/c1-10-11(19)6-12-16(2)9-22-15(21)18(16,24-25(3,4)5)13-7-17(10,12)8-14(20)23-13/h6,10,13H,7-9H2,1-5H3/t10-,13?,16?,17?,18?/m1/s1 |
| InChIKey | YYJURGIUJVERJW-GKOYDRGQSA-N |
| XLogP | 1.99 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|