C14H20O4 — CID 134954412
(1R)-5-hydroxy-9,9-dimethoxytricyclo[6.2.2.01,6]dodec-11-en-10-one (PubChem CID 134954412) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (1R)-5-hydroxy-9,9-dimethoxytricyclo[6.2.2.01,6]dodec-11-en-10-one.
| Compound Name | (1R)-5-hydroxy-9,9-dimethoxytricyclo[6.2.2.01,6]dodec-11-en-10-one |
|---|---|
| PubChem CID | 134954412 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (1R)-5-hydroxy-9,9-dimethoxytricyclo[6.2.2.01,6]dodec-11-en-10-one |
| SMILES | COC1(OC)C(=O)[C@]23C=CC1CC2C(O)CCC3 |
| InChI | InChI=1S/C14H20O4/c1-17-14(18-2)9-5-7-13(12(14)16)6-3-4-11(15)10(13)8-9/h5,7,9-11,15H,3-4,6,8H2,1-2H3/t9?,10?,11?,13-/m1/s1 |
| InChIKey | NAYFYRUNBPEBAK-GDDIVIBPSA-N |
| XLogP | 1.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|