C10H8OS3 — CID 134954448
4-(3-methoxyphenyl)-1,3-dithiole-2-thione (PubChem CID 134954448) has the molecular formula C10H8OS3 and a molecular weight of 240.37 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-1,3-dithiole-2-thione.
| Compound Name | 4-(3-methoxyphenyl)-1,3-dithiole-2-thione |
|---|---|
| PubChem CID | 134954448 |
| Molecular Formula | C10H8OS3 |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 239.97 |
| IUPAC Name | 4-(3-methoxyphenyl)-1,3-dithiole-2-thione |
| SMILES | COc1cccc(-c2csc(=S)s2)c1 |
| InChI | InChI=1S/C10H8OS3/c1-11-8-4-2-3-7(5-8)9-6-13-10(12)14-9/h2-6H,1H3 |
| InChIKey | LNDGSSFXSUJVBU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|