C22H30N2O3S — CID 134954524
(5R,7aS)-N,N,4,7a-tetramethyl-2-(4-methylphenyl)sulfonylspiro[1,3,5,7-tetrahydroisoindole-6,1'-cyclopropane]-5-carboxamide (PubChem CID 134954524) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is (5R,7aS)-N,N,4,7a-tetramethyl-2-(4-methylphenyl)sulfonylspiro[1,3,5,7-tetrahydroisoindole-6,1'-cyclopropane]-5-carboxamide.
| Compound Name | (5R,7aS)-N,N,4,7a-tetramethyl-2-(4-methylphenyl)sulfonylspiro[1,3,5,7-tetrahydroisoindole-6,1'-cyclopropane]-5-carboxamide |
|---|---|
| PubChem CID | 134954524 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (5R,7aS)-N,N,4,7a-tetramethyl-2-(4-methylphenyl)sulfonylspiro[1,3,5,7-tetrahydroisoindole-6,1'-cyclopropane]-5-carboxamide |
| SMILES | CC1=C2CN(S(=O)(=O)c3ccc(C)cc3)C[C@@]2(C)CC2(CC2)[C@H]1C(=O)N(C)C |
| InChI | InChI=1S/C22H30N2O3S/c1-15-6-8-17(9-7-15)28(26,27)24-12-18-16(2)19(20(25)23(4)5)22(10-11-22)13-21(18,3)14-24/h6-9,19H,10-14H2,1-5H3/t19-,21-/m1/s1 |
| InChIKey | YRGLFQMTJNDWJC-TZIWHRDSSA-N |
| XLogP | 3.21 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|