C23H32N2O3S — CID 134954526
(5R,7aS)-7a-ethyl-N,N,4-trimethyl-2-(4-methylphenyl)sulfonylspiro[1,3,5,7-tetrahydroisoindole-6,1'-cyclopropane]-5-carboxamide (PubChem CID 134954526) has the molecular formula C23H32N2O3S and a molecular weight of 416.59 g/mol. Its IUPAC name is (5R,7aS)-7a-ethyl-N,N,4-trimethyl-2-(4-methylphenyl)sulfonylspiro[1,3,5,7-tetrahydroisoindole-6,1'-cyclopropane]-5-carboxamide.
| Compound Name | (5R,7aS)-7a-ethyl-N,N,4-trimethyl-2-(4-methylphenyl)sulfonylspiro[1,3,5,7-tetrahydroisoindole-6,1'-cyclopropane]-5-carboxamide |
|---|---|
| PubChem CID | 134954526 |
| Molecular Formula | C23H32N2O3S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (5R,7aS)-7a-ethyl-N,N,4-trimethyl-2-(4-methylphenyl)sulfonylspiro[1,3,5,7-tetrahydroisoindole-6,1'-cyclopropane]-5-carboxamide |
| SMILES | CC[C@@]12CN(S(=O)(=O)c3ccc(C)cc3)CC1=C(C)[C@H](C(=O)N(C)C)C1(CC1)C2 |
| InChI | InChI=1S/C23H32N2O3S/c1-6-22-14-23(11-12-23)20(21(26)24(4)5)17(3)19(22)13-25(15-22)29(27,28)18-9-7-16(2)8-10-18/h7-10,20H,6,11-15H2,1-5H3/t20-,22-/m1/s1 |
| InChIKey | JUHZILZLKFZAHZ-IFMALSPDSA-N |
| XLogP | 3.60 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|