C18H30ClNO2 — CID 134954646
2-[(1S,4aS,7S,8aS)-7-chloro-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-N-methoxy-N-methylacetamide (PubChem CID 134954646) has the molecular formula C18H30ClNO2 and a molecular weight of 327.90 g/mol. Its IUPAC name is 2-[(1S,4aS,7S,8aS)-7-chloro-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-N-methoxy-N-methylacetamide.
| Compound Name | 2-[(1S,4aS,7S,8aS)-7-chloro-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 134954646 |
| Molecular Formula | C18H30ClNO2 |
| Molecular Weight | 327.90 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 2-[(1S,4aS,7S,8aS)-7-chloro-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-N-methoxy-N-methylacetamide |
| SMILES | C=C1CC[C@H]2C(C)(C)C[C@H](Cl)C[C@]2(C)[C@H]1CC(=O)N(C)OC |
| InChI | InChI=1S/C18H30ClNO2/c1-12-7-8-15-17(2,3)10-13(19)11-18(15,4)14(12)9-16(21)20(5)22-6/h13-15H,1,7-11H2,2-6H3/t13-,14-,15-,18+/m0/s1 |
| InChIKey | AMCWAZQZDJFUAN-YRBFXIGRSA-N |
| XLogP | 4.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.90 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|