C19H24FNO6 — CID 134954681
3-O,4-O-diethyl 2-O-methyl (2S,3R,4S,5R)-5-(4-fluorophenyl)-2-methylpyrrolidine-2,3,4-tricarboxylate (PubChem CID 134954681) has the molecular formula C19H24FNO6 and a molecular weight of 381.40 g/mol. Its IUPAC name is 3-O,4-O-diethyl 2-O-methyl (2S,3R,4S,5R)-5-(4-fluorophenyl)-2-methylpyrrolidine-2,3,4-tricarboxylate.
| Compound Name | 3-O,4-O-diethyl 2-O-methyl (2S,3R,4S,5R)-5-(4-fluorophenyl)-2-methylpyrrolidine-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 134954681 |
| Molecular Formula | C19H24FNO6 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 3-O,4-O-diethyl 2-O-methyl (2S,3R,4S,5R)-5-(4-fluorophenyl)-2-methylpyrrolidine-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H](C(=O)OCC)[C@@](C)(C(=O)OC)N[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H24FNO6/c1-5-26-16(22)13-14(17(23)27-6-2)19(3,18(24)25-4)21-15(13)11-7-9-12(20)10-8-11/h7-10,13-15,21H,5-6H2,1-4H3/t13-,14-,15-,19-/m0/s1 |
| InChIKey | PUTKBHCLCHABPP-XLPNERPQSA-N |
| XLogP | 1.76 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|