About N-oxoethanimidamide
N-oxoethanimidamide (PubChem CID 134954797) has the molecular formula C2H4N2O
and a molecular weight of 72.07 g/mol. Its IUPAC name is N-oxoethanimidamide.
Molecular Properties
| Compound Name | N-oxoethanimidamide |
| PubChem CID | 134954797 |
| Molecular Formula | C2H4N2O |
| Molecular Weight | 72.07 g/mol |
| Exact Mass | 72.03 |
| IUPAC Name | N-oxoethanimidamide |
| SMILES | [H]/N=C(\C)N=O |
| InChI | InChI=1S/C2H4N2O/c1-2(3)4-5/h3H,1H3/b3-2+ |
| InChIKey | CEXSZAUGXXHEBX-NSCUHMNNSA-N |
| XLogP | 0.75 |
| TPSA | 53.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 72.07 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-oxoethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-oxoethanimidamide?
The IUPAC name of N-oxoethanimidamide (CID 134954797) is N-oxoethanimidamide.
What is the SMILES notation for N-oxoethanimidamide?
The canonical SMILES for N-oxoethanimidamide is [H]/N=C(\C)N=O.
What is the InChIKey of N-oxoethanimidamide?
The InChIKey is CEXSZAUGXXHEBX-NSCUHMNNSA-N. The full InChI is InChI=1S/C2H4N2O/c1-2(3)4-5/h3H,1H3/b3-2+.
What are the key properties of N-oxoethanimidamide?
N-oxoethanimidamide has a molecular weight of 72.07 g/mol, XLogP of 0.75, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-oxoethanimidamide is sourced from PubChem (CID 134954797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).