C25H22F3NO3S — CID 134954820
(2R,4R)-4-ethenyl-3-(4-methylphenyl)sulfonyl-4-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazolidine (PubChem CID 134954820) has the molecular formula C25H22F3NO3S and a molecular weight of 473.52 g/mol. Its IUPAC name is (2R,4R)-4-ethenyl-3-(4-methylphenyl)sulfonyl-4-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazolidine.
| Compound Name | (2R,4R)-4-ethenyl-3-(4-methylphenyl)sulfonyl-4-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazolidine |
|---|---|
| PubChem CID | 134954820 |
| Molecular Formula | C25H22F3NO3S |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | (2R,4R)-4-ethenyl-3-(4-methylphenyl)sulfonyl-4-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazolidine |
| SMILES | C=C[C@@]1(c2ccccc2)CO[C@H](c2ccc(C(F)(F)F)cc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H22F3NO3S/c1-3-24(20-7-5-4-6-8-20)17-32-23(19-11-13-21(14-12-19)25(26,27)28)29(24)33(30,31)22-15-9-18(2)10-16-22/h3-16,23H,1,17H2,2H3/t23-,24+/m1/s1 |
| InChIKey | YEJXRKPUAFGDCC-RPWUZVMVSA-N |
| XLogP | 5.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|