C24H49IO4Si2 — CID 134954933
(2S,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[(4S)-5-[(Z)-3-iodoprop-2-enyl]-4-methyloxolan-2-yl]butan-2-ol (PubChem CID 134954933) has the molecular formula C24H49IO4Si2 and a molecular weight of 584.73 g/mol. Its IUPAC name is (2S,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[(4S)-5-[(Z)-3-iodoprop-2-enyl]-4-methyloxolan-2-yl]butan-2-ol.
| Compound Name | (2S,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[(4S)-5-[(Z)-3-iodoprop-2-enyl]-4-methyloxolan-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 134954933 |
| Molecular Formula | C24H49IO4Si2 |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | (2S,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[(4S)-5-[(Z)-3-iodoprop-2-enyl]-4-methyloxolan-2-yl]butan-2-ol |
| SMILES | C[C@H]1CC([C@H](C[C@H](O)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)OC1C/C=C\I |
| InChI | InChI=1S/C24H49IO4Si2/c1-18-15-21(28-20(18)13-12-14-25)22(29-31(10,11)24(5,6)7)16-19(26)17-27-30(8,9)23(2,3)4/h12,14,18-22,26H,13,15-17H2,1-11H3/b14-12-/t18-,19-,20?,21?,22-/m0/s1 |
| InChIKey | ZNJJMYKLWROPNY-SWHLOTMWSA-N |
| XLogP | 7.28 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|