C22H18FNO7 — CID 134955179
dimethyl (2R,3R)-2-(1,3-dioxoisoindol-2-yl)-3-[2-(4-fluorophenyl)-2-oxoethyl]butanedioate (PubChem CID 134955179) has the molecular formula C22H18FNO7 and a molecular weight of 427.38 g/mol. Its IUPAC name is dimethyl (2R,3R)-2-(1,3-dioxoisoindol-2-yl)-3-[2-(4-fluorophenyl)-2-oxoethyl]butanedioate.
| Compound Name | dimethyl (2R,3R)-2-(1,3-dioxoisoindol-2-yl)-3-[2-(4-fluorophenyl)-2-oxoethyl]butanedioate |
|---|---|
| PubChem CID | 134955179 |
| Molecular Formula | C22H18FNO7 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | dimethyl (2R,3R)-2-(1,3-dioxoisoindol-2-yl)-3-[2-(4-fluorophenyl)-2-oxoethyl]butanedioate |
| SMILES | COC(=O)[C@H](CC(=O)c1ccc(F)cc1)[C@H](C(=O)OC)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H18FNO7/c1-30-21(28)16(11-17(25)12-7-9-13(23)10-8-12)18(22(29)31-2)24-19(26)14-5-3-4-6-15(14)20(24)27/h3-10,16,18H,11H2,1-2H3/t16-,18-/m1/s1 |
| InChIKey | SJLZHDQUVAPFJI-SJLPKXTDSA-N |
| XLogP | 2.03 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|