C46H36N2O2 — CID 134955231
4-[2-[4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]-2-phenyl-1-pyridin-4-ylethenyl]pyridine (PubChem CID 134955231) has the molecular formula C46H36N2O2 and a molecular weight of 648.81 g/mol. Its IUPAC name is 4-[2-[4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]-2-phenyl-1-pyridin-4-ylethenyl]pyridine.
| Compound Name | 4-[2-[4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]-2-phenyl-1-pyridin-4-ylethenyl]pyridine |
|---|---|
| PubChem CID | 134955231 |
| Molecular Formula | C46H36N2O2 |
| Molecular Weight | 648.81 g/mol |
| Exact Mass | 648.28 |
| IUPAC Name | 4-[2-[4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]-2-phenyl-1-pyridin-4-ylethenyl]pyridine |
| SMILES | COc1ccc(C(=C(c2ccccc2)c2ccc(C(=C(c3ccncc3)c3ccncc3)c3ccccc3)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C46H36N2O2/c1-49-41-21-17-37(18-22-41)45(38-19-23-42(50-2)24-20-38)43(33-9-5-3-6-10-33)35-13-15-36(16-14-35)44(34-11-7-4-8-12-34)46(39-25-29-47-30-26-39)40-27-31-48-32-28-40/h3-32H,1-2H3 |
| InChIKey | WNADZMRRELZCDZ-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.81 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|