C22H14F3NO2S — CID 134955283
(3S)-1-benzyl-3-hydroxy-3-(2-thiophen-2-ylethynyl)-7-(trifluoromethyl)indol-2-one (PubChem CID 134955283) has the molecular formula C22H14F3NO2S and a molecular weight of 413.42 g/mol. Its IUPAC name is (3S)-1-benzyl-3-hydroxy-3-(2-thiophen-2-ylethynyl)-7-(trifluoromethyl)indol-2-one.
| Compound Name | (3S)-1-benzyl-3-hydroxy-3-(2-thiophen-2-ylethynyl)-7-(trifluoromethyl)indol-2-one |
|---|---|
| PubChem CID | 134955283 |
| Molecular Formula | C22H14F3NO2S |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | (3S)-1-benzyl-3-hydroxy-3-(2-thiophen-2-ylethynyl)-7-(trifluoromethyl)indol-2-one |
| SMILES | O=C1N(Cc2ccccc2)c2c(C(F)(F)F)cccc2[C@@]1(O)C#Cc1cccs1 |
| InChI | InChI=1S/C22H14F3NO2S/c23-22(24,25)18-10-4-9-17-19(18)26(14-15-6-2-1-3-7-15)20(27)21(17,28)12-11-16-8-5-13-29-16/h1-10,13,28H,14H2/t21-/m0/s1 |
| InChIKey | VQIXMXKAZXJYLU-NRFANRHFSA-N |
| XLogP | 4.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|