C22H30 — CID 134955292
1-methyl-2-[(4S)-4-[(4-methylphenyl)methyl]heptyl]benzene (PubChem CID 134955292) has the molecular formula C22H30 and a molecular weight of 294.48 g/mol. Its IUPAC name is 1-methyl-2-[(4S)-4-[(4-methylphenyl)methyl]heptyl]benzene.
| Compound Name | 1-methyl-2-[(4S)-4-[(4-methylphenyl)methyl]heptyl]benzene |
|---|---|
| PubChem CID | 134955292 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 1-methyl-2-[(4S)-4-[(4-methylphenyl)methyl]heptyl]benzene |
| SMILES | CCCC(CCCc1ccccc1C)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C22H30/c1-4-8-20(17-21-15-13-18(2)14-16-21)10-7-12-22-11-6-5-9-19(22)3/h5-6,9,11,13-16,20H,4,7-8,10,12,17H2,1-3H3 |
| InChIKey | QKVHLOXKHMBLEU-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |