C22H24F3NO3S2 — CID 134955319
N-butyl-4-methyl-N-[(3R)-4,4,4-trifluoro-3-hydroxy-3-(4-methylsulfanylphenyl)but-1-ynyl]benzenesulfonamide (PubChem CID 134955319) has the molecular formula C22H24F3NO3S2 and a molecular weight of 471.57 g/mol. Its IUPAC name is N-butyl-4-methyl-N-[(3R)-4,4,4-trifluoro-3-hydroxy-3-(4-methylsulfanylphenyl)but-1-ynyl]benzenesulfonamide.
| Compound Name | N-butyl-4-methyl-N-[(3R)-4,4,4-trifluoro-3-hydroxy-3-(4-methylsulfanylphenyl)but-1-ynyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134955319 |
| Molecular Formula | C22H24F3NO3S2 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | N-butyl-4-methyl-N-[(3R)-4,4,4-trifluoro-3-hydroxy-3-(4-methylsulfanylphenyl)but-1-ynyl]benzenesulfonamide |
| SMILES | CCCCN(C#C[C@](O)(c1ccc(SC)cc1)C(F)(F)F)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H24F3NO3S2/c1-4-5-15-26(31(28,29)20-12-6-17(2)7-13-20)16-14-21(27,22(23,24)25)18-8-10-19(30-3)11-9-18/h6-13,27H,4-5,15H2,1-3H3/t21-/m0/s1 |
| InChIKey | ANFNSATZZLJHCB-NRFANRHFSA-N |
| XLogP | 4.92 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|